C16H24N4O5S2 — CID 17378667
methyl 5-(dimethylcarbamoyl)-4-methyl-2-[[(2-methylpropan-2-yl)oxycarbonylamino]carbamothioylamino]thiophene-3-carboxylate (PubChem CID 17378667) has the molecular formula C16H24N4O5S2 and a molecular weight of 416.53 g/mol. Its IUPAC name is methyl 5-(dimethylcarbamoyl)-4-methyl-2-[[(2-methylpropan-2-yl)oxycarbonylamino]carbamothioylamino]thiophene-3-carboxylate.
| Compound Name | methyl 5-(dimethylcarbamoyl)-4-methyl-2-[[(2-methylpropan-2-yl)oxycarbonylamino]carbamothioylamino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 17378667 |
| Molecular Formula | C16H24N4O5S2 |
| Molecular Weight | 416.53 g/mol |
| Exact Mass | 416.12 |
| IUPAC Name | methyl 5-(dimethylcarbamoyl)-4-methyl-2-[[(2-methylpropan-2-yl)oxycarbonylamino]carbamothioylamino]thiophene-3-carboxylate |
| SMILES | COC(=O)c1c(NC(=S)NNC(=O)OC(C)(C)C)sc(C(=O)N(C)C)c1C |
| InChI | InChI=1S/C16H24N4O5S2/c1-8-9(13(22)24-7)11(27-10(8)12(21)20(5)6)17-14(26)18-19-15(23)25-16(2,3)4/h1-7H3,(H,19,23)(H2,17,18,26) |
| InChIKey | HNVLQFSULVDWSF-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 109.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.53 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|