C18H22N4O5S3 — CID 19649506
methyl 5-(dimethylcarbamoyl)-4-methyl-2-[(4-sulfamoylphenyl)methylcarbamothioylamino]thiophene-3-carboxylate (PubChem CID 19649506) has the molecular formula C18H22N4O5S3 and a molecular weight of 470.60 g/mol. Its IUPAC name is methyl 5-(dimethylcarbamoyl)-4-methyl-2-[(4-sulfamoylphenyl)methylcarbamothioylamino]thiophene-3-carboxylate.
| Compound Name | methyl 5-(dimethylcarbamoyl)-4-methyl-2-[(4-sulfamoylphenyl)methylcarbamothioylamino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 19649506 |
| Molecular Formula | C18H22N4O5S3 |
| Molecular Weight | 470.60 g/mol |
| Exact Mass | 470.08 |
| IUPAC Name | methyl 5-(dimethylcarbamoyl)-4-methyl-2-[(4-sulfamoylphenyl)methylcarbamothioylamino]thiophene-3-carboxylate |
| SMILES | COC(=O)c1c(NC(=S)NCc2ccc(S(N)(=O)=O)cc2)sc(C(=O)N(C)C)c1C |
| InChI | InChI=1S/C18H22N4O5S3/c1-10-13(17(24)27-4)15(29-14(10)16(23)22(2)3)21-18(28)20-9-11-5-7-12(8-6-11)30(19,25)26/h5-8H,9H2,1-4H3,(H2,19,25,26)(H2,20,21,28) |
| InChIKey | GRKYWXIFPSLXPW-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 130.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.60 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|