C18H23N5O4S2 — CID 17370811
methyl 5-(dimethylcarbamoyl)-4-methyl-2-[[[2-(1-methylpyrrol-2-yl)acetyl]amino]carbamothioylamino]thiophene-3-carboxylate (PubChem CID 17370811) has the molecular formula C18H23N5O4S2 and a molecular weight of 437.55 g/mol. Its IUPAC name is methyl 5-(dimethylcarbamoyl)-4-methyl-2-[[[2-(1-methylpyrrol-2-yl)acetyl]amino]carbamothioylamino]thiophene-3-carboxylate.
| Compound Name | methyl 5-(dimethylcarbamoyl)-4-methyl-2-[[[2-(1-methylpyrrol-2-yl)acetyl]amino]carbamothioylamino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 17370811 |
| Molecular Formula | C18H23N5O4S2 |
| Molecular Weight | 437.55 g/mol |
| Exact Mass | 437.12 |
| IUPAC Name | methyl 5-(dimethylcarbamoyl)-4-methyl-2-[[[2-(1-methylpyrrol-2-yl)acetyl]amino]carbamothioylamino]thiophene-3-carboxylate |
| SMILES | COC(=O)c1c(NC(=S)NNC(=O)Cc2cccn2C)sc(C(=O)N(C)C)c1C |
| InChI | InChI=1S/C18H23N5O4S2/c1-10-13(17(26)27-5)15(29-14(10)16(25)22(2)3)19-18(28)21-20-12(24)9-11-7-6-8-23(11)4/h6-8H,9H2,1-5H3,(H,20,24)(H2,19,21,28) |
| InChIKey | RPMOGDZNOPCBBS-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 104.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.55 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|