C22H27BrN4O4S3 — CID 2955043
methyl 2-[[[2-[(2-bromophenyl)methylsulfanyl]acetyl]amino]carbamothioylamino]-5-(diethylcarbamoyl)-4-methylthiophene-3-carboxylate (PubChem CID 2955043) has the molecular formula C22H27BrN4O4S3 and a molecular weight of 587.59 g/mol. Its IUPAC name is methyl 2-[[[2-[(2-bromophenyl)methylsulfanyl]acetyl]amino]carbamothioylamino]-5-(diethylcarbamoyl)-4-methylthiophene-3-carboxylate.
| Compound Name | methyl 2-[[[2-[(2-bromophenyl)methylsulfanyl]acetyl]amino]carbamothioylamino]-5-(diethylcarbamoyl)-4-methylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 2955043 |
| Molecular Formula | C22H27BrN4O4S3 |
| Molecular Weight | 587.59 g/mol |
| Exact Mass | 586.04 |
| IUPAC Name | methyl 2-[[[2-[(2-bromophenyl)methylsulfanyl]acetyl]amino]carbamothioylamino]-5-(diethylcarbamoyl)-4-methylthiophene-3-carboxylate |
| SMILES | CCN(CC)C(=O)c1sc(NC(=S)NNC(=O)CSCc2ccccc2Br)c(C(=O)OC)c1C |
| InChI | InChI=1S/C22H27BrN4O4S3/c1-5-27(6-2)20(29)18-13(3)17(21(30)31-4)19(34-18)24-22(32)26-25-16(28)12-33-11-14-9-7-8-10-15(14)23/h7-10H,5-6,11-12H2,1-4H3,(H,25,28)(H2,24,26,32) |
| InChIKey | FIAKNLIMEKCWFS-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.59 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|