C16H25N3O3S2 — CID 19650752
methyl 5-(dimethylcarbamoyl)-4-methyl-2-(pentylcarbamothioylamino)thiophene-3-carboxylate (PubChem CID 19650752) has the molecular formula C16H25N3O3S2 and a molecular weight of 371.53 g/mol. Its IUPAC name is methyl 5-(dimethylcarbamoyl)-4-methyl-2-(pentylcarbamothioylamino)thiophene-3-carboxylate.
| Compound Name | methyl 5-(dimethylcarbamoyl)-4-methyl-2-(pentylcarbamothioylamino)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 19650752 |
| Molecular Formula | C16H25N3O3S2 |
| Molecular Weight | 371.53 g/mol |
| Exact Mass | 371.13 |
| IUPAC Name | methyl 5-(dimethylcarbamoyl)-4-methyl-2-(pentylcarbamothioylamino)thiophene-3-carboxylate |
| SMILES | CCCCCNC(=S)Nc1sc(C(=O)N(C)C)c(C)c1C(=O)OC |
| InChI | InChI=1S/C16H25N3O3S2/c1-6-7-8-9-17-16(23)18-13-11(15(21)22-5)10(2)12(24-13)14(20)19(3)4/h6-9H2,1-5H3,(H2,17,18,23) |
| InChIKey | ADXWTTNGUHGBPR-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.53 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|