C15H21N3O4S2 — CID 19653726
methyl 5-(dimethylcarbamoyl)-4-methyl-2-(morpholine-4-carbothioylamino)thiophene-3-carboxylate (PubChem CID 19653726) has the molecular formula C15H21N3O4S2 and a molecular weight of 371.48 g/mol. Its IUPAC name is methyl 5-(dimethylcarbamoyl)-4-methyl-2-(morpholine-4-carbothioylamino)thiophene-3-carboxylate.
| Compound Name | methyl 5-(dimethylcarbamoyl)-4-methyl-2-(morpholine-4-carbothioylamino)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 19653726 |
| Molecular Formula | C15H21N3O4S2 |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.10 |
| IUPAC Name | methyl 5-(dimethylcarbamoyl)-4-methyl-2-(morpholine-4-carbothioylamino)thiophene-3-carboxylate |
| SMILES | COC(=O)c1c(NC(=S)N2CCOCC2)sc(C(=O)N(C)C)c1C |
| InChI | InChI=1S/C15H21N3O4S2/c1-9-10(14(20)21-4)12(24-11(9)13(19)17(2)3)16-15(23)18-5-7-22-8-6-18/h5-8H2,1-4H3,(H,16,23) |
| InChIKey | NEAAFBOEWJDPEI-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|