C18H20N2O3S2 — CID 4511830
methyl 5-methyl-2-(morpholine-4-carbothioylamino)-4-phenylthiophene-3-carboxylate (PubChem CID 4511830) has the molecular formula C18H20N2O3S2 and a molecular weight of 376.50 g/mol. Its IUPAC name is methyl 5-methyl-2-(morpholine-4-carbothioylamino)-4-phenylthiophene-3-carboxylate.
| Compound Name | methyl 5-methyl-2-(morpholine-4-carbothioylamino)-4-phenylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 4511830 |
| Molecular Formula | C18H20N2O3S2 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.09 |
| IUPAC Name | methyl 5-methyl-2-(morpholine-4-carbothioylamino)-4-phenylthiophene-3-carboxylate |
| SMILES | COC(=O)c1c(NC(=S)N2CCOCC2)sc(C)c1-c1ccccc1 |
| InChI | InChI=1S/C18H20N2O3S2/c1-12-14(13-6-4-3-5-7-13)15(17(21)22-2)16(25-12)19-18(24)20-8-10-23-11-9-20/h3-7H,8-11H2,1-2H3,(H,19,24) |
| InChIKey | GJCBWKFOSAJSKD-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|