C26H29N3O2S2 — CID 19655355
methyl 5-methyl-2-[[3-methyl-4-(4-methylphenyl)piperazine-1-carbothioyl]amino]-4-phenylthiophene-3-carboxylate (PubChem CID 19655355) has the molecular formula C26H29N3O2S2 and a molecular weight of 479.67 g/mol. Its IUPAC name is methyl 5-methyl-2-[[3-methyl-4-(4-methylphenyl)piperazine-1-carbothioyl]amino]-4-phenylthiophene-3-carboxylate.
| Compound Name | methyl 5-methyl-2-[[3-methyl-4-(4-methylphenyl)piperazine-1-carbothioyl]amino]-4-phenylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 19655355 |
| Molecular Formula | C26H29N3O2S2 |
| Molecular Weight | 479.67 g/mol |
| Exact Mass | 479.17 |
| IUPAC Name | methyl 5-methyl-2-[[3-methyl-4-(4-methylphenyl)piperazine-1-carbothioyl]amino]-4-phenylthiophene-3-carboxylate |
| SMILES | COC(=O)c1c(NC(=S)N2CCN(c3ccc(C)cc3)C(C)C2)sc(C)c1-c1ccccc1 |
| InChI | InChI=1S/C26H29N3O2S2/c1-17-10-12-21(13-11-17)29-15-14-28(16-18(29)2)26(32)27-24-23(25(30)31-4)22(19(3)33-24)20-8-6-5-7-9-20/h5-13,18H,14-16H2,1-4H3,(H,27,32) |
| InChIKey | FYRHQCQBYZWKCM-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.67 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|