C21H27N3O2S — CID 2207452
(3S)-N-(3,5-dimethoxyphenyl)-3-methyl-4-(4-methylphenyl)piperazine-1-carbothioamide (PubChem CID 2207452) has the molecular formula C21H27N3O2S and a molecular weight of 385.53 g/mol. Its IUPAC name is (3S)-N-(3,5-dimethoxyphenyl)-3-methyl-4-(4-methylphenyl)piperazine-1-carbothioamide.
| Compound Name | (3S)-N-(3,5-dimethoxyphenyl)-3-methyl-4-(4-methylphenyl)piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 2207452 |
| Molecular Formula | C21H27N3O2S |
| Molecular Weight | 385.53 g/mol |
| Exact Mass | 385.18 |
| IUPAC Name | (3S)-N-(3,5-dimethoxyphenyl)-3-methyl-4-(4-methylphenyl)piperazine-1-carbothioamide |
| SMILES | COc1cc(NC(=S)N2CCN(c3ccc(C)cc3)[C@@H](C)C2)cc(OC)c1 |
| InChI | InChI=1S/C21H27N3O2S/c1-15-5-7-18(8-6-15)24-10-9-23(14-16(24)2)21(27)22-17-11-19(25-3)13-20(12-17)26-4/h5-8,11-13,16H,9-10,14H2,1-4H3,(H,22,27)/t16-/m0/s1 |
| InChIKey | AJQCGXPWHSCKRJ-INIZCTEOSA-N |
| XLogP | 3.92 |
| TPSA | 36.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.53 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|