C19H21Cl2N3S — CID 19655308
N-(2,3-dichlorophenyl)-3-methyl-4-(4-methylphenyl)piperazine-1-carbothioamide (PubChem CID 19655308) has the molecular formula C19H21Cl2N3S and a molecular weight of 394.37 g/mol. Its IUPAC name is N-(2,3-dichlorophenyl)-3-methyl-4-(4-methylphenyl)piperazine-1-carbothioamide.
| Compound Name | N-(2,3-dichlorophenyl)-3-methyl-4-(4-methylphenyl)piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 19655308 |
| Molecular Formula | C19H21Cl2N3S |
| Molecular Weight | 394.37 g/mol |
| Exact Mass | 393.08 |
| IUPAC Name | N-(2,3-dichlorophenyl)-3-methyl-4-(4-methylphenyl)piperazine-1-carbothioamide |
| SMILES | Cc1ccc(N2CCN(C(=S)Nc3cccc(Cl)c3Cl)CC2C)cc1 |
| InChI | InChI=1S/C19H21Cl2N3S/c1-13-6-8-15(9-7-13)24-11-10-23(12-14(24)2)19(25)22-17-5-3-4-16(20)18(17)21/h3-9,14H,10-12H2,1-2H3,(H,22,25) |
| InChIKey | HQUKMVPRPHHUKD-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.37 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|