C19H23N3O3S — CID 17372757
N-(3,5-dimethoxyphenyl)-4-(4-hydroxyphenyl)piperazine-1-carbothioamide (PubChem CID 17372757) has the molecular formula C19H23N3O3S and a molecular weight of 373.48 g/mol. Its IUPAC name is N-(3,5-dimethoxyphenyl)-4-(4-hydroxyphenyl)piperazine-1-carbothioamide.
| Compound Name | N-(3,5-dimethoxyphenyl)-4-(4-hydroxyphenyl)piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 17372757 |
| Molecular Formula | C19H23N3O3S |
| Molecular Weight | 373.48 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | N-(3,5-dimethoxyphenyl)-4-(4-hydroxyphenyl)piperazine-1-carbothioamide |
| SMILES | COc1cc(NC(=S)N2CCN(c3ccc(O)cc3)CC2)cc(OC)c1 |
| InChI | InChI=1S/C19H23N3O3S/c1-24-17-11-14(12-18(13-17)25-2)20-19(26)22-9-7-21(8-10-22)15-3-5-16(23)6-4-15/h3-6,11-13,23H,7-10H2,1-2H3,(H,20,26) |
| InChIKey | WKXZVSIDNCYQNW-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 57.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.48 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|