C15H21N3O3S — CID 800272
1-[(3,5-dimethoxyphenyl)carbamothioyl]piperidine-4-carboxamide (PubChem CID 800272) has the molecular formula C15H21N3O3S and a molecular weight of 323.42 g/mol. Its IUPAC name is 1-[(3,5-dimethoxyphenyl)carbamothioyl]piperidine-4-carboxamide.
| Compound Name | 1-[(3,5-dimethoxyphenyl)carbamothioyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 800272 |
| Molecular Formula | C15H21N3O3S |
| Molecular Weight | 323.42 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | 1-[(3,5-dimethoxyphenyl)carbamothioyl]piperidine-4-carboxamide |
| SMILES | COc1cc(NC(=S)N2CCC(C(N)=O)CC2)cc(OC)c1 |
| InChI | InChI=1S/C15H21N3O3S/c1-20-12-7-11(8-13(9-12)21-2)17-15(22)18-5-3-10(4-6-18)14(16)19/h7-10H,3-6H2,1-2H3,(H2,16,19)(H,17,22) |
| InChIKey | WYEDVBDXDIHEDN-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.42 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|