C21H27N3O4 — CID 42998885
N-(3,5-dimethoxyphenyl)-2-[4-(4-hydroxyphenyl)piperazin-1-yl]propanamide (PubChem CID 42998885) has the molecular formula C21H27N3O4 and a molecular weight of 385.46 g/mol. Its IUPAC name is N-(3,5-dimethoxyphenyl)-2-[4-(4-hydroxyphenyl)piperazin-1-yl]propanamide.
| Compound Name | N-(3,5-dimethoxyphenyl)-2-[4-(4-hydroxyphenyl)piperazin-1-yl]propanamide |
|---|---|
| PubChem CID | 42998885 |
| Molecular Formula | C21H27N3O4 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.20 |
| IUPAC Name | N-(3,5-dimethoxyphenyl)-2-[4-(4-hydroxyphenyl)piperazin-1-yl]propanamide |
| SMILES | COc1cc(NC(=O)C(C)N2CCN(c3ccc(O)cc3)CC2)cc(OC)c1 |
| InChI | InChI=1S/C21H27N3O4/c1-15(21(26)22-16-12-19(27-2)14-20(13-16)28-3)23-8-10-24(11-9-23)17-4-6-18(25)7-5-17/h4-7,12-15,25H,8-11H2,1-3H3,(H,22,26) |
| InChIKey | FPDCCIZYMUVEGW-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 74.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |