C19H21Cl2N3O2 — CID 2096596
(2S)-N-(3,5-dichlorophenyl)-2-[4-(4-hydroxyphenyl)piperazin-1-yl]propanamide (PubChem CID 2096596) has the molecular formula C19H21Cl2N3O2 and a molecular weight of 394.30 g/mol. Its IUPAC name is (2S)-N-(3,5-dichlorophenyl)-2-[4-(4-hydroxyphenyl)piperazin-1-yl]propanamide.
| Compound Name | (2S)-N-(3,5-dichlorophenyl)-2-[4-(4-hydroxyphenyl)piperazin-1-yl]propanamide |
|---|---|
| PubChem CID | 2096596 |
| Molecular Formula | C19H21Cl2N3O2 |
| Molecular Weight | 394.30 g/mol |
| Exact Mass | 393.10 |
| IUPAC Name | (2S)-N-(3,5-dichlorophenyl)-2-[4-(4-hydroxyphenyl)piperazin-1-yl]propanamide |
| SMILES | C[C@@H](C(=O)Nc1cc(Cl)cc(Cl)c1)N1CCN(c2ccc(O)cc2)CC1 |
| InChI | InChI=1S/C19H21Cl2N3O2/c1-13(19(26)22-16-11-14(20)10-15(21)12-16)23-6-8-24(9-7-23)17-2-4-18(25)5-3-17/h2-5,10-13,25H,6-9H2,1H3,(H,22,26)/t13-/m0/s1 |
| InChIKey | XOGMMJOMCSIGGW-ZDUSSCGKSA-N |
| XLogP | 3.85 |
| TPSA | 55.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.30 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |