C20H24N2O2S2 — CID 19653704
ethyl 5-methyl-4-phenyl-2-(piperidine-1-carbothioylamino)thiophene-3-carboxylate (PubChem CID 19653704) has the molecular formula C20H24N2O2S2 and a molecular weight of 388.56 g/mol. Its IUPAC name is ethyl 5-methyl-4-phenyl-2-(piperidine-1-carbothioylamino)thiophene-3-carboxylate.
| Compound Name | ethyl 5-methyl-4-phenyl-2-(piperidine-1-carbothioylamino)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 19653704 |
| Molecular Formula | C20H24N2O2S2 |
| Molecular Weight | 388.56 g/mol |
| Exact Mass | 388.13 |
| IUPAC Name | ethyl 5-methyl-4-phenyl-2-(piperidine-1-carbothioylamino)thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=S)N2CCCCC2)sc(C)c1-c1ccccc1 |
| InChI | InChI=1S/C20H24N2O2S2/c1-3-24-19(23)17-16(15-10-6-4-7-11-15)14(2)26-18(17)21-20(25)22-12-8-5-9-13-22/h4,6-7,10-11H,3,5,8-9,12-13H2,1-2H3,(H,21,25) |
| InChIKey | XYBKOTKJCBIHCR-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.56 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|