C22H28N2O2S2 — CID 19650495
ethyl 2-(cycloheptylcarbamothioylamino)-5-methyl-4-phenylthiophene-3-carboxylate (PubChem CID 19650495) has the molecular formula C22H28N2O2S2 and a molecular weight of 416.61 g/mol. Its IUPAC name is ethyl 2-(cycloheptylcarbamothioylamino)-5-methyl-4-phenylthiophene-3-carboxylate.
| Compound Name | ethyl 2-(cycloheptylcarbamothioylamino)-5-methyl-4-phenylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 19650495 |
| Molecular Formula | C22H28N2O2S2 |
| Molecular Weight | 416.61 g/mol |
| Exact Mass | 416.16 |
| IUPAC Name | ethyl 2-(cycloheptylcarbamothioylamino)-5-methyl-4-phenylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=S)NC2CCCCCC2)sc(C)c1-c1ccccc1 |
| InChI | InChI=1S/C22H28N2O2S2/c1-3-26-21(25)19-18(16-11-7-6-8-12-16)15(2)28-20(19)24-22(27)23-17-13-9-4-5-10-14-17/h6-8,11-12,17H,3-5,9-10,13-14H2,1-2H3,(H2,23,24,27) |
| InChIKey | VSOBZQYWDMBCKW-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.61 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|