C21H25NO3S2 — CID 7825650
ethyl 2-[(2-cyclopentylsulfanylacetyl)amino]-5-methyl-4-phenylthiophene-3-carboxylate (PubChem CID 7825650) has the molecular formula C21H25NO3S2 and a molecular weight of 403.57 g/mol. Its IUPAC name is ethyl 2-[(2-cyclopentylsulfanylacetyl)amino]-5-methyl-4-phenylthiophene-3-carboxylate.
| Compound Name | ethyl 2-[(2-cyclopentylsulfanylacetyl)amino]-5-methyl-4-phenylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 7825650 |
| Molecular Formula | C21H25NO3S2 |
| Molecular Weight | 403.57 g/mol |
| Exact Mass | 403.13 |
| IUPAC Name | ethyl 2-[(2-cyclopentylsulfanylacetyl)amino]-5-methyl-4-phenylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)CSC2CCCC2)sc(C)c1-c1ccccc1 |
| InChI | InChI=1S/C21H25NO3S2/c1-3-25-21(24)19-18(15-9-5-4-6-10-15)14(2)27-20(19)22-17(23)13-26-16-11-7-8-12-16/h4-6,9-10,16H,3,7-8,11-13H2,1-2H3,(H,22,23) |
| InChIKey | IFRCEQYPVOMAHS-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.57 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|