C23H30N2O4S — CID 112826257
ethyl 2-[3-[4-(hydroxymethyl)piperidin-1-yl]propanoylamino]-5-methyl-4-phenylthiophene-3-carboxylate (PubChem CID 112826257) has the molecular formula C23H30N2O4S and a molecular weight of 430.57 g/mol. Its IUPAC name is ethyl 2-[3-[4-(hydroxymethyl)piperidin-1-yl]propanoylamino]-5-methyl-4-phenylthiophene-3-carboxylate.
| Compound Name | ethyl 2-[3-[4-(hydroxymethyl)piperidin-1-yl]propanoylamino]-5-methyl-4-phenylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 112826257 |
| Molecular Formula | C23H30N2O4S |
| Molecular Weight | 430.57 g/mol |
| Exact Mass | 430.19 |
| IUPAC Name | ethyl 2-[3-[4-(hydroxymethyl)piperidin-1-yl]propanoylamino]-5-methyl-4-phenylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)CCN2CCC(CO)CC2)sc(C)c1-c1ccccc1 |
| InChI | InChI=1S/C23H30N2O4S/c1-3-29-23(28)21-20(18-7-5-4-6-8-18)16(2)30-22(21)24-19(27)11-14-25-12-9-17(15-26)10-13-25/h4-8,17,26H,3,9-15H2,1-2H3,(H,24,27) |
| InChIKey | JRKDPIVNTBEEPK-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.57 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|