C21H29N3O3S+2 — CID 8896186
ethyl 5-methyl-2-[[2-(4-methylpiperazine-1,4-diium-1-yl)acetyl]amino]-4-phenylthiophene-3-carboxylate (PubChem CID 8896186) has the molecular formula C21H29N3O3S+2 and a molecular weight of 403.55 g/mol. Its IUPAC name is ethyl 5-methyl-2-[[2-(4-methylpiperazine-1,4-diium-1-yl)acetyl]amino]-4-phenylthiophene-3-carboxylate.
| Compound Name | ethyl 5-methyl-2-[[2-(4-methylpiperazine-1,4-diium-1-yl)acetyl]amino]-4-phenylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 8896186 |
| Molecular Formula | C21H29N3O3S+2 |
| Molecular Weight | 403.55 g/mol |
| Exact Mass | 403.19 |
| IUPAC Name | ethyl 5-methyl-2-[[2-(4-methylpiperazine-1,4-diium-1-yl)acetyl]amino]-4-phenylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)C[NH+]2CC[NH+](C)CC2)sc(C)c1-c1ccccc1 |
| InChI | InChI=1S/C21H27N3O3S/c1-4-27-21(26)19-18(16-8-6-5-7-9-16)15(2)28-20(19)22-17(25)14-24-12-10-23(3)11-13-24/h5-9H,4,10-14H2,1-3H3,(H,22,25)/p+2 |
| InChIKey | QFFLOHWCUIOVRP-UHFFFAOYSA-P |
| XLogP | 0.25 |
| TPSA | 64.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.55 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|