C21H29N3O4S+2 — CID 7673641
ethyl 2-[[2-[4-(2-hydroxyethyl)piperazine-1,4-diium-1-yl]acetyl]amino]-4-phenylthiophene-3-carboxylate (PubChem CID 7673641) has the molecular formula C21H29N3O4S+2 and a molecular weight of 419.55 g/mol. Its IUPAC name is ethyl 2-[[2-[4-(2-hydroxyethyl)piperazine-1,4-diium-1-yl]acetyl]amino]-4-phenylthiophene-3-carboxylate.
| Compound Name | ethyl 2-[[2-[4-(2-hydroxyethyl)piperazine-1,4-diium-1-yl]acetyl]amino]-4-phenylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 7673641 |
| Molecular Formula | C21H29N3O4S+2 |
| Molecular Weight | 419.55 g/mol |
| Exact Mass | 419.19 |
| IUPAC Name | ethyl 2-[[2-[4-(2-hydroxyethyl)piperazine-1,4-diium-1-yl]acetyl]amino]-4-phenylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccccc2)csc1NC(=O)C[NH+]1CC[NH+](CCO)CC1 |
| InChI | InChI=1S/C21H27N3O4S/c1-2-28-21(27)19-17(16-6-4-3-5-7-16)15-29-20(19)22-18(26)14-24-10-8-23(9-11-24)12-13-25/h3-7,15,25H,2,8-14H2,1H3,(H,22,26)/p+2 |
| InChIKey | GRWUBPLVNCWNKR-UHFFFAOYSA-P |
| XLogP | -0.69 |
| TPSA | 84.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.55 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|