C21H27N2O3S+ — CID 7673650
cyclohexyl-[2-[(3-ethoxycarbonyl-4-phenylthiophen-2-yl)amino]-2-oxoethyl]azanium (PubChem CID 7673650) has the molecular formula C21H27N2O3S+ and a molecular weight of 387.53 g/mol. Its IUPAC name is cyclohexyl-[2-[(3-ethoxycarbonyl-4-phenylthiophen-2-yl)amino]-2-oxoethyl]azanium.
| Compound Name | cyclohexyl-[2-[(3-ethoxycarbonyl-4-phenylthiophen-2-yl)amino]-2-oxoethyl]azanium |
|---|---|
| PubChem CID | 7673650 |
| Molecular Formula | C21H27N2O3S+ |
| Molecular Weight | 387.53 g/mol |
| Exact Mass | 387.17 |
| IUPAC Name | cyclohexyl-[2-[(3-ethoxycarbonyl-4-phenylthiophen-2-yl)amino]-2-oxoethyl]azanium |
| SMILES | CCOC(=O)c1c(-c2ccccc2)csc1NC(=O)C[NH2+]C1CCCCC1 |
| InChI | InChI=1S/C21H26N2O3S/c1-2-26-21(25)19-17(15-9-5-3-6-10-15)14-27-20(19)23-18(24)13-22-16-11-7-4-8-12-16/h3,5-6,9-10,14,16,22H,2,4,7-8,11-13H2,1H3,(H,23,24)/p+1 |
| InChIKey | MGKHMOLABUTPBI-UHFFFAOYSA-O |
| XLogP | 3.43 |
| TPSA | 72.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.53 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|