C24H31NO3S — CID 28693110
ethyl 2-(3-cyclohexylpropanoylamino)-4-(4-ethylphenyl)thiophene-3-carboxylate (PubChem CID 28693110) has the molecular formula C24H31NO3S and a molecular weight of 413.58 g/mol. Its IUPAC name is ethyl 2-(3-cyclohexylpropanoylamino)-4-(4-ethylphenyl)thiophene-3-carboxylate.
| Compound Name | ethyl 2-(3-cyclohexylpropanoylamino)-4-(4-ethylphenyl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 28693110 |
| Molecular Formula | C24H31NO3S |
| Molecular Weight | 413.58 g/mol |
| Exact Mass | 413.20 |
| IUPAC Name | ethyl 2-(3-cyclohexylpropanoylamino)-4-(4-ethylphenyl)thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccc(CC)cc2)csc1NC(=O)CCC1CCCCC1 |
| InChI | InChI=1S/C24H31NO3S/c1-3-17-10-13-19(14-11-17)20-16-29-23(22(20)24(27)28-4-2)25-21(26)15-12-18-8-6-5-7-9-18/h10-11,13-14,16,18H,3-9,12,15H2,1-2H3,(H,25,26) |
| InChIKey | FOKZTTXOVRWCMY-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.58 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|