C22H26N2O7S2 — CID 55944434
[2-[(3-ethoxycarbonyl-5-methyl-4-phenylthiophen-2-yl)amino]-2-oxoethyl] (2S)-1-methylsulfonylpyrrolidine-2-carboxylate (PubChem CID 55944434) has the molecular formula C22H26N2O7S2 and a molecular weight of 494.59 g/mol. Its IUPAC name is [2-[(3-ethoxycarbonyl-5-methyl-4-phenylthiophen-2-yl)amino]-2-oxoethyl] (2S)-1-methylsulfonylpyrrolidine-2-carboxylate.
| Compound Name | [2-[(3-ethoxycarbonyl-5-methyl-4-phenylthiophen-2-yl)amino]-2-oxoethyl] (2S)-1-methylsulfonylpyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 55944434 |
| Molecular Formula | C22H26N2O7S2 |
| Molecular Weight | 494.59 g/mol |
| Exact Mass | 494.12 |
| IUPAC Name | [2-[(3-ethoxycarbonyl-5-methyl-4-phenylthiophen-2-yl)amino]-2-oxoethyl] (2S)-1-methylsulfonylpyrrolidine-2-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)COC(=O)[C@@H]2CCCN2S(C)(=O)=O)sc(C)c1-c1ccccc1 |
| InChI | InChI=1S/C22H26N2O7S2/c1-4-30-22(27)19-18(15-9-6-5-7-10-15)14(2)32-20(19)23-17(25)13-31-21(26)16-11-8-12-24(16)33(3,28)29/h5-7,9-10,16H,4,8,11-13H2,1-3H3,(H,23,25)/t16-/m0/s1 |
| InChIKey | ULYTTWKEJLHSGJ-INIZCTEOSA-N |
| XLogP | 2.81 |
| TPSA | 119.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.59 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|