C17H23NO4S2 — CID 7395651
ethyl 5-acetyl-2-[(2-cyclopentylsulfanylacetyl)amino]-4-methylthiophene-3-carboxylate (PubChem CID 7395651) has the molecular formula C17H23NO4S2 and a molecular weight of 369.51 g/mol. Its IUPAC name is ethyl 5-acetyl-2-[(2-cyclopentylsulfanylacetyl)amino]-4-methylthiophene-3-carboxylate.
| Compound Name | ethyl 5-acetyl-2-[(2-cyclopentylsulfanylacetyl)amino]-4-methylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 7395651 |
| Molecular Formula | C17H23NO4S2 |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 369.11 |
| IUPAC Name | ethyl 5-acetyl-2-[(2-cyclopentylsulfanylacetyl)amino]-4-methylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)CSC2CCCC2)sc(C(C)=O)c1C |
| InChI | InChI=1S/C17H23NO4S2/c1-4-22-17(21)14-10(2)15(11(3)19)24-16(14)18-13(20)9-23-12-7-5-6-8-12/h12H,4-9H2,1-3H3,(H,18,20) |
| InChIKey | UPBJGJBYCXERMC-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |