C20H31N2O4S+ — CID 9265081
[2-[(5-acetyl-3-ethoxycarbonyl-4-methylthiophen-2-yl)amino]-2-oxoethyl]-cyclooctylazanium (PubChem CID 9265081) has the molecular formula C20H31N2O4S+ and a molecular weight of 395.55 g/mol. Its IUPAC name is [2-[(5-acetyl-3-ethoxycarbonyl-4-methylthiophen-2-yl)amino]-2-oxoethyl]-cyclooctylazanium.
| Compound Name | [2-[(5-acetyl-3-ethoxycarbonyl-4-methylthiophen-2-yl)amino]-2-oxoethyl]-cyclooctylazanium |
|---|---|
| PubChem CID | 9265081 |
| Molecular Formula | C20H31N2O4S+ |
| Molecular Weight | 395.55 g/mol |
| Exact Mass | 395.20 |
| IUPAC Name | [2-[(5-acetyl-3-ethoxycarbonyl-4-methylthiophen-2-yl)amino]-2-oxoethyl]-cyclooctylazanium |
| SMILES | CCOC(=O)c1c(NC(=O)C[NH2+]C2CCCCCCC2)sc(C(C)=O)c1C |
| InChI | InChI=1S/C20H30N2O4S/c1-4-26-20(25)17-13(2)18(14(3)23)27-19(17)22-16(24)12-21-15-10-8-6-5-7-9-11-15/h15,21H,4-12H2,1-3H3,(H,22,24)/p+1 |
| InChIKey | HRVWGXMNZBZXTF-UHFFFAOYSA-O |
| XLogP | 3.05 |
| TPSA | 89.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.55 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |