C23H23N3O4S2 — CID 4955273
4,5-dimethyl-2-[[3-(2-phenoxyethoxy)benzoyl]carbamothioylamino]thiophene-3-carboxamide (PubChem CID 4955273) has the molecular formula C23H23N3O4S2 and a molecular weight of 469.59 g/mol. Its IUPAC name is 4,5-dimethyl-2-[[3-(2-phenoxyethoxy)benzoyl]carbamothioylamino]thiophene-3-carboxamide.
| Compound Name | 4,5-dimethyl-2-[[3-(2-phenoxyethoxy)benzoyl]carbamothioylamino]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 4955273 |
| Molecular Formula | C23H23N3O4S2 |
| Molecular Weight | 469.59 g/mol |
| Exact Mass | 469.11 |
| IUPAC Name | 4,5-dimethyl-2-[[3-(2-phenoxyethoxy)benzoyl]carbamothioylamino]thiophene-3-carboxamide |
| SMILES | Cc1sc(NC(=S)NC(=O)c2cccc(OCCOc3ccccc3)c2)c(C(N)=O)c1C |
| InChI | InChI=1S/C23H23N3O4S2/c1-14-15(2)32-22(19(14)20(24)27)26-23(31)25-21(28)16-7-6-10-18(13-16)30-12-11-29-17-8-4-3-5-9-17/h3-10,13H,11-12H2,1-2H3,(H2,24,27)(H2,25,26,28,31) |
| InChIKey | RBACQIPDTBBUMN-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.59 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|