C22H22N2O4S — CID 4954977
4,5-dimethyl-2-[[3-(2-phenoxyethoxy)benzoyl]amino]thiophene-3-carboxamide (PubChem CID 4954977) has the molecular formula C22H22N2O4S and a molecular weight of 410.50 g/mol. Its IUPAC name is 4,5-dimethyl-2-[[3-(2-phenoxyethoxy)benzoyl]amino]thiophene-3-carboxamide.
| Compound Name | 4,5-dimethyl-2-[[3-(2-phenoxyethoxy)benzoyl]amino]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 4954977 |
| Molecular Formula | C22H22N2O4S |
| Molecular Weight | 410.50 g/mol |
| Exact Mass | 410.13 |
| IUPAC Name | 4,5-dimethyl-2-[[3-(2-phenoxyethoxy)benzoyl]amino]thiophene-3-carboxamide |
| SMILES | Cc1sc(NC(=O)c2cccc(OCCOc3ccccc3)c2)c(C(N)=O)c1C |
| InChI | InChI=1S/C22H22N2O4S/c1-14-15(2)29-22(19(14)20(23)25)24-21(26)16-7-6-10-18(13-16)28-12-11-27-17-8-4-3-5-9-17/h3-10,13H,11-12H2,1-2H3,(H2,23,25)(H,24,26) |
| InChIKey | IDSXOJCDDFXJQP-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.50 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|