C21H26N2O5S — CID 7521216
ethyl 4-carbamoyl-3-methyl-5-[(3-pentoxybenzoyl)amino]thiophene-2-carboxylate (PubChem CID 7521216) has the molecular formula C21H26N2O5S and a molecular weight of 418.52 g/mol. Its IUPAC name is ethyl 4-carbamoyl-3-methyl-5-[(3-pentoxybenzoyl)amino]thiophene-2-carboxylate.
| Compound Name | ethyl 4-carbamoyl-3-methyl-5-[(3-pentoxybenzoyl)amino]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 7521216 |
| Molecular Formula | C21H26N2O5S |
| Molecular Weight | 418.52 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | ethyl 4-carbamoyl-3-methyl-5-[(3-pentoxybenzoyl)amino]thiophene-2-carboxylate |
| SMILES | CCCCCOc1cccc(C(=O)Nc2sc(C(=O)OCC)c(C)c2C(N)=O)c1 |
| InChI | InChI=1S/C21H26N2O5S/c1-4-6-7-11-28-15-10-8-9-14(12-15)19(25)23-20-16(18(22)24)13(3)17(29-20)21(26)27-5-2/h8-10,12H,4-7,11H2,1-3H3,(H2,22,24)(H,23,25) |
| InChIKey | GQIXDPOFMHBGJU-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.52 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|