C23H24N2O3S — CID 16857860
2-[(3-pentoxybenzoyl)amino]-5-phenylthiophene-3-carboxamide (PubChem CID 16857860) has the molecular formula C23H24N2O3S and a molecular weight of 408.52 g/mol. Its IUPAC name is 2-[(3-pentoxybenzoyl)amino]-5-phenylthiophene-3-carboxamide.
| Compound Name | 2-[(3-pentoxybenzoyl)amino]-5-phenylthiophene-3-carboxamide |
|---|---|
| PubChem CID | 16857860 |
| Molecular Formula | C23H24N2O3S |
| Molecular Weight | 408.52 g/mol |
| Exact Mass | 408.15 |
| IUPAC Name | 2-[(3-pentoxybenzoyl)amino]-5-phenylthiophene-3-carboxamide |
| SMILES | CCCCCOc1cccc(C(=O)Nc2sc(-c3ccccc3)cc2C(N)=O)c1 |
| InChI | InChI=1S/C23H24N2O3S/c1-2-3-7-13-28-18-12-8-11-17(14-18)22(27)25-23-19(21(24)26)15-20(29-23)16-9-5-4-6-10-16/h4-6,8-12,14-15H,2-3,7,13H2,1H3,(H2,24,26)(H,25,27) |
| InChIKey | KMFZGAHZBRYKBK-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.52 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|