C20H18N2O4S — CID 16857829
2-[(3,4-dimethoxybenzoyl)amino]-5-phenylthiophene-3-carboxamide (PubChem CID 16857829) has the molecular formula C20H18N2O4S and a molecular weight of 382.44 g/mol. Its IUPAC name is 2-[(3,4-dimethoxybenzoyl)amino]-5-phenylthiophene-3-carboxamide.
| Compound Name | 2-[(3,4-dimethoxybenzoyl)amino]-5-phenylthiophene-3-carboxamide |
|---|---|
| PubChem CID | 16857829 |
| Molecular Formula | C20H18N2O4S |
| Molecular Weight | 382.44 g/mol |
| Exact Mass | 382.10 |
| IUPAC Name | 2-[(3,4-dimethoxybenzoyl)amino]-5-phenylthiophene-3-carboxamide |
| SMILES | COc1ccc(C(=O)Nc2sc(-c3ccccc3)cc2C(N)=O)cc1OC |
| InChI | InChI=1S/C20H18N2O4S/c1-25-15-9-8-13(10-16(15)26-2)19(24)22-20-14(18(21)23)11-17(27-20)12-6-4-3-5-7-12/h3-11H,1-2H3,(H2,21,23)(H,22,24) |
| InChIKey | YRTNENONPDKXJV-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.44 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |