C21H19N3O3S — CID 9113396
2-[[2-(4-acetylanilino)acetyl]amino]-5-phenylthiophene-3-carboxamide (PubChem CID 9113396) has the molecular formula C21H19N3O3S and a molecular weight of 393.47 g/mol. Its IUPAC name is 2-[[2-(4-acetylanilino)acetyl]amino]-5-phenylthiophene-3-carboxamide.
| Compound Name | 2-[[2-(4-acetylanilino)acetyl]amino]-5-phenylthiophene-3-carboxamide |
|---|---|
| PubChem CID | 9113396 |
| Molecular Formula | C21H19N3O3S |
| Molecular Weight | 393.47 g/mol |
| Exact Mass | 393.11 |
| IUPAC Name | 2-[[2-(4-acetylanilino)acetyl]amino]-5-phenylthiophene-3-carboxamide |
| SMILES | CC(=O)c1ccc(NCC(=O)Nc2sc(-c3ccccc3)cc2C(N)=O)cc1 |
| InChI | InChI=1S/C21H19N3O3S/c1-13(25)14-7-9-16(10-8-14)23-12-19(26)24-21-17(20(22)27)11-18(28-21)15-5-3-2-4-6-15/h2-11,23H,12H2,1H3,(H2,22,27)(H,24,26) |
| InChIKey | GYNLKRMTQLQQKS-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.47 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |