C19H17N3O2S — CID 118729460
2-[(4-methylphenyl)carbamoylamino]-5-phenylthiophene-3-carboxamide (PubChem CID 118729460) has the molecular formula C19H17N3O2S and a molecular weight of 351.43 g/mol. Its IUPAC name is 2-[(4-methylphenyl)carbamoylamino]-5-phenylthiophene-3-carboxamide.
| Compound Name | 2-[(4-methylphenyl)carbamoylamino]-5-phenylthiophene-3-carboxamide |
|---|---|
| PubChem CID | 118729460 |
| Molecular Formula | C19H17N3O2S |
| Molecular Weight | 351.43 g/mol |
| Exact Mass | 351.10 |
| IUPAC Name | 2-[(4-methylphenyl)carbamoylamino]-5-phenylthiophene-3-carboxamide |
| SMILES | Cc1ccc(NC(=O)Nc2sc(-c3ccccc3)cc2C(N)=O)cc1 |
| InChI | InChI=1S/C19H17N3O2S/c1-12-7-9-14(10-8-12)21-19(24)22-18-15(17(20)23)11-16(25-18)13-5-3-2-4-6-13/h2-11H,1H3,(H2,20,23)(H2,21,22,24) |
| InChIKey | DBIAKDYDOUVVHQ-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.43 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |