C17H20N3O2S+ — CID 3534907
5-phenyl-2-[(2-pyrrolidin-1-ium-1-ylacetyl)amino]thiophene-3-carboxamide (PubChem CID 3534907) has the molecular formula C17H20N3O2S+ and a molecular weight of 330.43 g/mol. Its IUPAC name is 5-phenyl-2-[(2-pyrrolidin-1-ium-1-ylacetyl)amino]thiophene-3-carboxamide.
| Compound Name | 5-phenyl-2-[(2-pyrrolidin-1-ium-1-ylacetyl)amino]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 3534907 |
| Molecular Formula | C17H20N3O2S+ |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | 5-phenyl-2-[(2-pyrrolidin-1-ium-1-ylacetyl)amino]thiophene-3-carboxamide |
| SMILES | NC(=O)c1cc(-c2ccccc2)sc1NC(=O)C[NH+]1CCCC1 |
| InChI | InChI=1S/C17H19N3O2S/c18-16(22)13-10-14(12-6-2-1-3-7-12)23-17(13)19-15(21)11-20-8-4-5-9-20/h1-3,6-7,10H,4-5,8-9,11H2,(H2,18,22)(H,19,21)/p+1 |
| InChIKey | FUNUWASQFXPTEL-UHFFFAOYSA-O |
| XLogP | 1.13 |
| TPSA | 76.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |