C19H15FN2O2S2 — CID 16857900
2-[[2-(4-fluorophenyl)sulfanylacetyl]amino]-5-phenylthiophene-3-carboxamide (PubChem CID 16857900) has the molecular formula C19H15FN2O2S2 and a molecular weight of 386.47 g/mol. Its IUPAC name is 2-[[2-(4-fluorophenyl)sulfanylacetyl]amino]-5-phenylthiophene-3-carboxamide.
| Compound Name | 2-[[2-(4-fluorophenyl)sulfanylacetyl]amino]-5-phenylthiophene-3-carboxamide |
|---|---|
| PubChem CID | 16857900 |
| Molecular Formula | C19H15FN2O2S2 |
| Molecular Weight | 386.47 g/mol |
| Exact Mass | 386.06 |
| IUPAC Name | 2-[[2-(4-fluorophenyl)sulfanylacetyl]amino]-5-phenylthiophene-3-carboxamide |
| SMILES | NC(=O)c1cc(-c2ccccc2)sc1NC(=O)CSc1ccc(F)cc1 |
| InChI | InChI=1S/C19H15FN2O2S2/c20-13-6-8-14(9-7-13)25-11-17(23)22-19-15(18(21)24)10-16(26-19)12-4-2-1-3-5-12/h1-10H,11H2,(H2,21,24)(H,22,23) |
| InChIKey | DDCXCAAVVUWVOB-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.47 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |