C19H14ClFN2O2S — CID 7998372
2-[[2-(2-chloro-6-fluorophenyl)acetyl]amino]-5-phenylthiophene-3-carboxamide (PubChem CID 7998372) has the molecular formula C19H14ClFN2O2S and a molecular weight of 388.85 g/mol. Its IUPAC name is 2-[[2-(2-chloro-6-fluorophenyl)acetyl]amino]-5-phenylthiophene-3-carboxamide.
| Compound Name | 2-[[2-(2-chloro-6-fluorophenyl)acetyl]amino]-5-phenylthiophene-3-carboxamide |
|---|---|
| PubChem CID | 7998372 |
| Molecular Formula | C19H14ClFN2O2S |
| Molecular Weight | 388.85 g/mol |
| Exact Mass | 388.04 |
| IUPAC Name | 2-[[2-(2-chloro-6-fluorophenyl)acetyl]amino]-5-phenylthiophene-3-carboxamide |
| SMILES | NC(=O)c1cc(-c2ccccc2)sc1NC(=O)Cc1c(F)cccc1Cl |
| InChI | InChI=1S/C19H14ClFN2O2S/c20-14-7-4-8-15(21)12(14)10-17(24)23-19-13(18(22)25)9-16(26-19)11-5-2-1-3-6-11/h1-9H,10H2,(H2,22,25)(H,23,24) |
| InChIKey | ZETXHSQWQDXCMK-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.85 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |