C20H21ClFN3O2 — CID 17417314
2-[[2-(2-chloro-6-fluorophenyl)acetyl]amino]-5-piperidin-1-ylbenzamide (PubChem CID 17417314) has the molecular formula C20H21ClFN3O2 and a molecular weight of 389.86 g/mol. Its IUPAC name is 2-[[2-(2-chloro-6-fluorophenyl)acetyl]amino]-5-piperidin-1-ylbenzamide.
| Compound Name | 2-[[2-(2-chloro-6-fluorophenyl)acetyl]amino]-5-piperidin-1-ylbenzamide |
|---|---|
| PubChem CID | 17417314 |
| Molecular Formula | C20H21ClFN3O2 |
| Molecular Weight | 389.86 g/mol |
| Exact Mass | 389.13 |
| IUPAC Name | 2-[[2-(2-chloro-6-fluorophenyl)acetyl]amino]-5-piperidin-1-ylbenzamide |
| SMILES | NC(=O)c1cc(N2CCCCC2)ccc1NC(=O)Cc1c(F)cccc1Cl |
| InChI | InChI=1S/C20H21ClFN3O2/c21-16-5-4-6-17(22)14(16)12-19(26)24-18-8-7-13(11-15(18)20(23)27)25-9-2-1-3-10-25/h4-8,11H,1-3,9-10,12H2,(H2,23,27)(H,24,26) |
| InChIKey | CKIPTRVQVMFUMM-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.86 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |