C20H22ClN3O2 — CID 123997933
2-[[3-(chloromethyl)benzoyl]amino]-5-piperidin-1-ylbenzamide (PubChem CID 123997933) has the molecular formula C20H22ClN3O2 and a molecular weight of 371.87 g/mol. Its IUPAC name is 2-[[3-(chloromethyl)benzoyl]amino]-5-piperidin-1-ylbenzamide.
| Compound Name | 2-[[3-(chloromethyl)benzoyl]amino]-5-piperidin-1-ylbenzamide |
|---|---|
| PubChem CID | 123997933 |
| Molecular Formula | C20H22ClN3O2 |
| Molecular Weight | 371.87 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | 2-[[3-(chloromethyl)benzoyl]amino]-5-piperidin-1-ylbenzamide |
| SMILES | NC(=O)c1cc(N2CCCCC2)ccc1NC(=O)c1cccc(CCl)c1 |
| InChI | InChI=1S/C20H22ClN3O2/c21-13-14-5-4-6-15(11-14)20(26)23-18-8-7-16(12-17(18)19(22)25)24-9-2-1-3-10-24/h4-8,11-12H,1-3,9-10,13H2,(H2,22,25)(H,23,26) |
| InChIKey | HBOCDNDFFTWAIR-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.87 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|