C36H38N4O4S — CID 129268771
4-[2-[4-[[2-[[3-(ethylaminosulfanyl)benzoyl]amino]-5-piperidin-1-ylbenzoyl]amino]phenyl]ethyl]benzoic acid (PubChem CID 129268771) has the molecular formula C36H38N4O4S and a molecular weight of 622.79 g/mol. Its IUPAC name is 4-[2-[4-[[2-[[3-(ethylaminosulfanyl)benzoyl]amino]-5-piperidin-1-ylbenzoyl]amino]phenyl]ethyl]benzoic acid.
| Compound Name | 4-[2-[4-[[2-[[3-(ethylaminosulfanyl)benzoyl]amino]-5-piperidin-1-ylbenzoyl]amino]phenyl]ethyl]benzoic acid |
|---|---|
| PubChem CID | 129268771 |
| Molecular Formula | C36H38N4O4S |
| Molecular Weight | 622.79 g/mol |
| Exact Mass | 622.26 |
| IUPAC Name | 4-[2-[4-[[2-[[3-(ethylaminosulfanyl)benzoyl]amino]-5-piperidin-1-ylbenzoyl]amino]phenyl]ethyl]benzoic acid |
| SMILES | CCNSc1cccc(C(=O)Nc2ccc(N3CCCCC3)cc2C(=O)Nc2ccc(CCc3ccc(C(=O)O)cc3)cc2)c1 |
| InChI | InChI=1S/C36H38N4O4S/c1-2-37-45-31-8-6-7-28(23-31)34(41)39-33-20-19-30(40-21-4-3-5-22-40)24-32(33)35(42)38-29-17-13-26(14-18-29)10-9-25-11-15-27(16-12-25)36(43)44/h6-8,11-20,23-24,37H,2-5,9-10,21-22H2,1H3,(H,38,42)(H,39,41)(H,43,44) |
| InChIKey | WYQVEWMLRHCCQE-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 110.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.79 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|