C43H48N4O5S — CID 129269136
4-[ethyl-[3-[[2-[[4-[2-(4-formylphenyl)ethyl]phenyl]carbamoyl]-4-piperidin-1-ylphenyl]carbamoyl]phenyl]sulfanylamino]cyclohexane-1-carboxylic acid (PubChem CID 129269136) has the molecular formula C43H48N4O5S and a molecular weight of 732.95 g/mol. Its IUPAC name is 4-[ethyl-[3-[[2-[[4-[2-(4-formylphenyl)ethyl]phenyl]carbamoyl]-4-piperidin-1-ylphenyl]carbamoyl]phenyl]sulfanylamino]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[ethyl-[3-[[2-[[4-[2-(4-formylphenyl)ethyl]phenyl]carbamoyl]-4-piperidin-1-ylphenyl]carbamoyl]phenyl]sulfanylamino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 129269136 |
| Molecular Formula | C43H48N4O5S |
| Molecular Weight | 732.95 g/mol |
| Exact Mass | 732.33 |
| IUPAC Name | 4-[ethyl-[3-[[2-[[4-[2-(4-formylphenyl)ethyl]phenyl]carbamoyl]-4-piperidin-1-ylphenyl]carbamoyl]phenyl]sulfanylamino]cyclohexane-1-carboxylic acid |
| SMILES | CCN(Sc1cccc(C(=O)Nc2ccc(N3CCCCC3)cc2C(=O)Nc2ccc(CCc3ccc(C=O)cc3)cc2)c1)C1CCC(C(=O)O)CC1 |
| InChI | InChI=1S/C43H48N4O5S/c1-2-47(36-21-17-33(18-22-36)43(51)52)53-38-8-6-7-34(27-38)41(49)45-40-24-23-37(46-25-4-3-5-26-46)28-39(40)42(50)44-35-19-15-31(16-20-35)10-9-30-11-13-32(29-48)14-12-30/h6-8,11-16,19-20,23-24,27-29,33,36H,2-5,9-10,17-18,21-22,25-26H2,1H3,(H,44,50)(H,45,49)(H,51,52) |
| InChIKey | SQISLSFETZGREV-UHFFFAOYSA-N |
| XLogP | 8.75 |
| TPSA | 119.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.95 |
| LogP ≤ 5 | 8.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|