C46H56N3O10+ — CID 144887905
[4-[2-[4-[[2-[[3-[3-[2-[2-[2-(2-carboxyethoxy)ethoxy]ethoxy]ethoxy]propyl]benzoyl]amino]-5-piperidin-1-ylbenzoyl]amino]phenyl]ethyl]benzoyl]oxidanium (PubChem CID 144887905) has the molecular formula C46H56N3O10+ and a molecular weight of 810.96 g/mol. Its IUPAC name is [4-[2-[4-[[2-[[3-[3-[2-[2-[2-(2-carboxyethoxy)ethoxy]ethoxy]ethoxy]propyl]benzoyl]amino]-5-piperidin-1-ylbenzoyl]amino]phenyl]ethyl]benzoyl]oxidanium.
| Compound Name | [4-[2-[4-[[2-[[3-[3-[2-[2-[2-(2-carboxyethoxy)ethoxy]ethoxy]ethoxy]propyl]benzoyl]amino]-5-piperidin-1-ylbenzoyl]amino]phenyl]ethyl]benzoyl]oxidanium |
|---|---|
| PubChem CID | 144887905 |
| Molecular Formula | C46H56N3O10+ |
| Molecular Weight | 810.96 g/mol |
| Exact Mass | 810.40 |
| IUPAC Name | [4-[2-[4-[[2-[[3-[3-[2-[2-[2-(2-carboxyethoxy)ethoxy]ethoxy]ethoxy]propyl]benzoyl]amino]-5-piperidin-1-ylbenzoyl]amino]phenyl]ethyl]benzoyl]oxidanium |
| SMILES | O=C(O)CCOCCOCCOCCOCCCc1cccc(C(=O)Nc2ccc(N3CCCCC3)cc2C(=O)Nc2ccc(CCc3ccc(C(=O)[OH2+])cc3)cc2)c1 |
| InChI | InChI=1S/C46H55N3O10/c50-43(51)21-25-57-27-29-59-31-30-58-28-26-56-24-5-7-36-6-4-8-38(32-36)44(52)48-42-20-19-40(49-22-2-1-3-23-49)33-41(42)45(53)47-39-17-13-35(14-18-39)10-9-34-11-15-37(16-12-34)46(54)55/h4,6,8,11-20,32-33H,1-3,5,7,9-10,21-31H2,(H,47,53)(H,48,52)(H,50,51)(H,54,55)/p+1 |
| InChIKey | JSWQVKIAKVFPPH-UHFFFAOYSA-O |
| XLogP | 6.31 |
| TPSA | 175.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 810.96 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|