C26H25N3O5 — CID 174864290
4-[2-[4-[(2-nitro-5-pyrrolidin-1-ylbenzoyl)amino]phenyl]ethyl]benzoic acid (PubChem CID 174864290) has the molecular formula C26H25N3O5 and a molecular weight of 459.50 g/mol. Its IUPAC name is 4-[2-[4-[(2-nitro-5-pyrrolidin-1-ylbenzoyl)amino]phenyl]ethyl]benzoic acid.
| Compound Name | 4-[2-[4-[(2-nitro-5-pyrrolidin-1-ylbenzoyl)amino]phenyl]ethyl]benzoic acid |
|---|---|
| PubChem CID | 174864290 |
| Molecular Formula | C26H25N3O5 |
| Molecular Weight | 459.50 g/mol |
| Exact Mass | 459.18 |
| IUPAC Name | 4-[2-[4-[(2-nitro-5-pyrrolidin-1-ylbenzoyl)amino]phenyl]ethyl]benzoic acid |
| SMILES | O=C(O)c1ccc(CCc2ccc(NC(=O)c3cc(N4CCCC4)ccc3[N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C26H25N3O5/c30-25(23-17-22(28-15-1-2-16-28)13-14-24(23)29(33)34)27-21-11-7-19(8-12-21)4-3-18-5-9-20(10-6-18)26(31)32/h5-14,17H,1-4,15-16H2,(H,27,30)(H,31,32) |
| InChIKey | TYFZJAGRBYGBST-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 112.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.50 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|