C20H22N4O4 — CID 42394048
4-methyl-3-nitro-N-[2-oxo-2-(4-pyrrolidin-1-ylanilino)ethyl]benzamide (PubChem CID 42394048) has the molecular formula C20H22N4O4 and a molecular weight of 382.42 g/mol. Its IUPAC name is 4-methyl-3-nitro-N-[2-oxo-2-(4-pyrrolidin-1-ylanilino)ethyl]benzamide.
| Compound Name | 4-methyl-3-nitro-N-[2-oxo-2-(4-pyrrolidin-1-ylanilino)ethyl]benzamide |
|---|---|
| PubChem CID | 42394048 |
| Molecular Formula | C20H22N4O4 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | 4-methyl-3-nitro-N-[2-oxo-2-(4-pyrrolidin-1-ylanilino)ethyl]benzamide |
| SMILES | Cc1ccc(C(=O)NCC(=O)Nc2ccc(N3CCCC3)cc2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H22N4O4/c1-14-4-5-15(12-18(14)24(27)28)20(26)21-13-19(25)22-16-6-8-17(9-7-16)23-10-2-3-11-23/h4-9,12H,2-3,10-11,13H2,1H3,(H,21,26)(H,22,25) |
| InChIKey | GCUWUJGRTKPRGM-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 104.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|