C21H24N4O5 — CID 24647270
N-[2-[4-(2,2-dimethylpropanoylamino)anilino]-2-oxoethyl]-4-methyl-3-nitrobenzamide (PubChem CID 24647270) has the molecular formula C21H24N4O5 and a molecular weight of 412.45 g/mol. Its IUPAC name is N-[2-[4-(2,2-dimethylpropanoylamino)anilino]-2-oxoethyl]-4-methyl-3-nitrobenzamide.
| Compound Name | N-[2-[4-(2,2-dimethylpropanoylamino)anilino]-2-oxoethyl]-4-methyl-3-nitrobenzamide |
|---|---|
| PubChem CID | 24647270 |
| Molecular Formula | C21H24N4O5 |
| Molecular Weight | 412.45 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | N-[2-[4-(2,2-dimethylpropanoylamino)anilino]-2-oxoethyl]-4-methyl-3-nitrobenzamide |
| SMILES | Cc1ccc(C(=O)NCC(=O)Nc2ccc(NC(=O)C(C)(C)C)cc2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H24N4O5/c1-13-5-6-14(11-17(13)25(29)30)19(27)22-12-18(26)23-15-7-9-16(10-8-15)24-20(28)21(2,3)4/h5-11H,12H2,1-4H3,(H,22,27)(H,23,26)(H,24,28) |
| InChIKey | FENRRKZDBHFHCC-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 130.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.45 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|