C23H19N5O4 — CID 24598095
N-[2-(4-imidazo[1,2-a]pyridin-2-ylanilino)-2-oxoethyl]-4-methyl-3-nitrobenzamide (PubChem CID 24598095) has the molecular formula C23H19N5O4 and a molecular weight of 429.44 g/mol. Its IUPAC name is N-[2-(4-imidazo[1,2-a]pyridin-2-ylanilino)-2-oxoethyl]-4-methyl-3-nitrobenzamide.
| Compound Name | N-[2-(4-imidazo[1,2-a]pyridin-2-ylanilino)-2-oxoethyl]-4-methyl-3-nitrobenzamide |
|---|---|
| PubChem CID | 24598095 |
| Molecular Formula | C23H19N5O4 |
| Molecular Weight | 429.44 g/mol |
| Exact Mass | 429.14 |
| IUPAC Name | N-[2-(4-imidazo[1,2-a]pyridin-2-ylanilino)-2-oxoethyl]-4-methyl-3-nitrobenzamide |
| SMILES | Cc1ccc(C(=O)NCC(=O)Nc2ccc(-c3cn4ccccc4n3)cc2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C23H19N5O4/c1-15-5-6-17(12-20(15)28(31)32)23(30)24-13-22(29)25-18-9-7-16(8-10-18)19-14-27-11-3-2-4-21(27)26-19/h2-12,14H,13H2,1H3,(H,24,30)(H,25,29) |
| InChIKey | JLPUFTMSZJSLES-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 118.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.44 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|