C21H16N4O3 — CID 121055658
N-(5-imidazo[1,2-a]pyridin-2-yl-2-methylphenyl)-4-nitrobenzamide (PubChem CID 121055658) has the molecular formula C21H16N4O3 and a molecular weight of 372.38 g/mol. Its IUPAC name is N-(5-imidazo[1,2-a]pyridin-2-yl-2-methylphenyl)-4-nitrobenzamide.
| Compound Name | N-(5-imidazo[1,2-a]pyridin-2-yl-2-methylphenyl)-4-nitrobenzamide |
|---|---|
| PubChem CID | 121055658 |
| Molecular Formula | C21H16N4O3 |
| Molecular Weight | 372.38 g/mol |
| Exact Mass | 372.12 |
| IUPAC Name | N-(5-imidazo[1,2-a]pyridin-2-yl-2-methylphenyl)-4-nitrobenzamide |
| SMILES | Cc1ccc(-c2cn3ccccc3n2)cc1NC(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C21H16N4O3/c1-14-5-6-16(19-13-24-11-3-2-4-20(24)22-19)12-18(14)23-21(26)15-7-9-17(10-8-15)25(27)28/h2-13H,1H3,(H,23,26) |
| InChIKey | RLKZVJRRVPVNKM-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.38 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|