C15H14N4S — CID 169358367
(5-imidazo[1,2-a]pyridin-2-yl-2-methylphenyl)thiourea (PubChem CID 169358367) has the molecular formula C15H14N4S and a molecular weight of 282.37 g/mol. Its IUPAC name is (5-imidazo[1,2-a]pyridin-2-yl-2-methylphenyl)thiourea.
| Compound Name | (5-imidazo[1,2-a]pyridin-2-yl-2-methylphenyl)thiourea |
|---|---|
| PubChem CID | 169358367 |
| Molecular Formula | C15H14N4S |
| Molecular Weight | 282.37 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | (5-imidazo[1,2-a]pyridin-2-yl-2-methylphenyl)thiourea |
| SMILES | Cc1ccc(-c2cn3ccccc3n2)cc1NC(N)=S |
| InChI | InChI=1S/C15H14N4S/c1-10-5-6-11(8-12(10)18-15(16)20)13-9-19-7-3-2-4-14(19)17-13/h2-9H,1H3,(H3,16,18,20) |
| InChIKey | JUTPHLBKPPAEKQ-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 55.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.37 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|