C15H15IN2 — CID 45134937
2-(3,4-dimethylphenyl)imidazo[1,2-a]pyridine;hydroiodide (PubChem CID 45134937) has the molecular formula C15H15IN2 and a molecular weight of 350.20 g/mol. Its IUPAC name is 2-(3,4-dimethylphenyl)imidazo[1,2-a]pyridine;hydroiodide.
| Compound Name | 2-(3,4-dimethylphenyl)imidazo[1,2-a]pyridine;hydroiodide |
|---|---|
| PubChem CID | 45134937 |
| Molecular Formula | C15H15IN2 |
| Molecular Weight | 350.20 g/mol |
| Exact Mass | 350.03 |
| IUPAC Name | 2-(3,4-dimethylphenyl)imidazo[1,2-a]pyridine;hydroiodide |
| SMILES | Cc1ccc(-c2cn3ccccc3n2)cc1C.I |
| InChI | InChI=1S/C15H14N2.HI/c1-11-6-7-13(9-12(11)2)14-10-17-8-4-3-5-15(17)16-14;/h3-10H,1-2H3;1H |
| InChIKey | PSXMCBFYOBYVFN-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.20 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|