C16H17N3O2S — CID 23608319
N-(5-imidazo[1,2-a]pyridin-2-yl-2-methylphenyl)ethanesulfonamide (PubChem CID 23608319) has the molecular formula C16H17N3O2S and a molecular weight of 315.40 g/mol. Its IUPAC name is N-(5-imidazo[1,2-a]pyridin-2-yl-2-methylphenyl)ethanesulfonamide.
| Compound Name | N-(5-imidazo[1,2-a]pyridin-2-yl-2-methylphenyl)ethanesulfonamide |
|---|---|
| PubChem CID | 23608319 |
| Molecular Formula | C16H17N3O2S |
| Molecular Weight | 315.40 g/mol |
| Exact Mass | 315.10 |
| IUPAC Name | N-(5-imidazo[1,2-a]pyridin-2-yl-2-methylphenyl)ethanesulfonamide |
| SMILES | CCS(=O)(=O)Nc1cc(-c2cn3ccccc3n2)ccc1C |
| InChI | InChI=1S/C16H17N3O2S/c1-3-22(20,21)18-14-10-13(8-7-12(14)2)15-11-19-9-5-4-6-16(19)17-15/h4-11,18H,3H2,1-2H3 |
| InChIKey | XKCMRJAXCLKOPK-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 63.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.40 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |