About 4-cyano-N-(5-imidazo[1,2-a]pyridin-2-yl-2-methylphenyl)benzenesulfonamide
4-cyano-N-(5-imidazo[1,2-a]pyridin-2-yl-2-methylphenyl)benzenesulfonamide (PubChem CID 122283678) has the molecular formula C21H16N4O2S
and a molecular weight of 388.45 g/mol. Its IUPAC name is 4-cyano-N-(5-imidazo[1,2-a]pyridin-2-yl-2-methylphenyl)benzenesulfonamide.
Molecular Properties
| Compound Name | 4-cyano-N-(5-imidazo[1,2-a]pyridin-2-yl-2-methylphenyl)benzenesulfonamide |
| PubChem CID | 122283678 |
| Molecular Formula | C21H16N4O2S |
| Molecular Weight | 388.45 g/mol |
| Exact Mass | 388.10 |
| IUPAC Name | 4-cyano-N-(5-imidazo[1,2-a]pyridin-2-yl-2-methylphenyl)benzenesulfonamide |
| SMILES | Cc1ccc(-c2cn3ccccc3n2)cc1NS(=O)(=O)c1ccc(C#N)cc1 |
| InChI | InChI=1S/C21H16N4O2S/c1-15-5-8-17(20-14-25-11-3-2-4-21(25)23-20)12-19(15)24-28(26,27)18-9-6-16(13-22)7-10-18/h2-12,14,24H,1H3 |
| InChIKey | JMSJIIYWJHBXQJ-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 87.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 388.45 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-cyano-N-(5-imidazo[1,2-a]pyridin-2-yl-2-methylphenyl)benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyano-N-(5-imidazo[1,2-a]pyridin-2-yl-2-methylphenyl)benzenesulfonamide?
The IUPAC name of 4-cyano-N-(5-imidazo[1,2-a]pyridin-2-yl-2-methylphenyl)benzenesulfonamide (CID 122283678) is 4-cyano-N-(5-imidazo[1,2-a]pyridin-2-yl-2-methylphenyl)benzenesulfonamide.
What is the SMILES notation for 4-cyano-N-(5-imidazo[1,2-a]pyridin-2-yl-2-methylphenyl)benzenesulfonamide?
The canonical SMILES for 4-cyano-N-(5-imidazo[1,2-a]pyridin-2-yl-2-methylphenyl)benzenesulfonamide is Cc1ccc(-c2cn3ccccc3n2)cc1NS(=O)(=O)c1ccc(C#N)cc1.
What is the InChIKey of 4-cyano-N-(5-imidazo[1,2-a]pyridin-2-yl-2-methylphenyl)benzenesulfonamide?
The InChIKey is JMSJIIYWJHBXQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H16N4O2S/c1-15-5-8-17(20-14-25-11-3-2-4-21(25)23-20)12-19(15)24-28(26,27)18-9-6-16(13-22)7-10-18/h2-12,14,24H,1H3.
What are the key properties of 4-cyano-N-(5-imidazo[1,2-a]pyridin-2-yl-2-methylphenyl)benzenesulfonamide?
4-cyano-N-(5-imidazo[1,2-a]pyridin-2-yl-2-methylphenyl)benzenesulfonamide has a molecular weight of 388.45 g/mol, XLogP of 3.98, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyano-N-(5-imidazo[1,2-a]pyridin-2-yl-2-methylphenyl)benzenesulfonamide is sourced from PubChem (CID 122283678), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).