C20H13N3 — CID 141122443
4-(4-imidazo[1,2-a]pyridin-2-ylphenyl)benzonitrile (PubChem CID 141122443) has the molecular formula C20H13N3 and a molecular weight of 295.35 g/mol. Its IUPAC name is 4-(4-imidazo[1,2-a]pyridin-2-ylphenyl)benzonitrile.
| Compound Name | 4-(4-imidazo[1,2-a]pyridin-2-ylphenyl)benzonitrile |
|---|---|
| PubChem CID | 141122443 |
| Molecular Formula | C20H13N3 |
| Molecular Weight | 295.35 g/mol |
| Exact Mass | 295.11 |
| IUPAC Name | 4-(4-imidazo[1,2-a]pyridin-2-ylphenyl)benzonitrile |
| SMILES | N#Cc1ccc(-c2ccc(-c3cn4ccccc4n3)cc2)cc1 |
| InChI | InChI=1S/C20H13N3/c21-13-15-4-6-16(7-5-15)17-8-10-18(11-9-17)19-14-23-12-2-1-3-20(23)22-19/h1-12,14H |
| InChIKey | OQDPRPDZLZHPSI-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 41.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.35 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |